DNA, RNA and Protein Synthesis Compounds: Small Molecules and Peptides
24 results for "DNA, RNA and Protein Synthesis Compounds Small Molecules and Peptides" in Products
24 results for "DNA, RNA and Protein Synthesis Compounds Small Molecules and Peptides" in Products
DNA, RNA and Protein Synthesis Compounds: Small Molecules and Peptides
Non-selective protein kinase inhibitor
| Alternate Names: | AM-2282 |
| Chemical Name: | [9S-(9α,10β,11β,13α)]-2,3,10,11,12,13-Hexahydro-10-methoxy-9-methyl-11-(methylamino)-9,13-epoxy-1H,9H-diindolo[1,2,3-gh:3',2',1'-lm]pyrrolo[3,4-j][1,7]benzodiazonin-1-one |
| Purity: | ≥98% (HPLC) |
Potent and selective herpes simplex virus (HSV) helicase primase inhibitor
| Chemical Name: | N-[5-(Aminosulfonyl)-4-methyl-2-thiazolyl]-N-methyl-4-(2-pyridinyl)benzeneacetamide |
| Purity: | ≥98% (HPLC) |
RNA conformation probe; reagent for COMRADES RNA platform
| Alternate Names: | psoralen-triethylene glycol azide |
| Chemical Name: | 3-(13-Azido-5,8,11-trioxa-2-azatridec-1-yl)-2,5,9-trimethyl-7H-furo[3,2-g][1]benzopyran-7-one |
| Purity: | ≥98% (HPLC) |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
Thymidine analog for labeling DNA; can be linked to a fluorophore by click chemistry
| Chemical Name: | 5-ethynyl-1-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥95% (HPLC) |
Antibiotic; inhibits 50S ribosomal subunit formation and elongation at transpeptidation
| Alternate Names: | CP 62993 |
| Chemical Name: | 13-[(2,6-Dideoxy-3-C-methyl-3-O-methyl-α-L-ribo-hexopyranosyl)oxy]-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-[[3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl]oxy]-1-oxa-6-azacyclopentadecan-15-one |
| Purity: | ≥99% (HPLC) |
Chemoproteomic reagent, clickable electrophilic purine for RNA binding profiling in live cells
| Chemical Name: | 2,6-Dichloro-7-(2-propyn-1-yl)-7H-purine |
| Purity: | ≥98% (HPLC) |
Reagent for RNA SHAPE-MaP experiments in live cells
| Chemical Name: | 1H-Imidazol-1-yl(2-methyl-3-furanyl)methanone |
Alkylating agent; chemotherapeutic
| Chemical Name: | 2-[Bis(2-chloroethyl)amino]tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide |
| Purity: | ≥99% (HPLC) |
Selective orthosteric inhibitor of the BRCA2-RAD51 interaction
| Chemical Name: | N-(2-((2S,4R)-2-(((S)-1-(2-Chloro-4-methoxyphenyl)ethyl)carbamoyl)-4-hydroxypyrrolidin-1-yl)-2-oxoethyl)-6-fluoroquinoline-2-carboxamide |
| Purity: | ≥98% (HPLC) |
Potent HTT pre-RNA splicing modulator
| Chemical Name: | 5-[(3R)-3-(Cyclopropylamino)-1-pyrrolidinyl]-N-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-2-pyrazinecarboxamide |
| Purity: | ≥98% (HPLC) |
DNA topoisomerase I inhibitor; Camptothecin (Cat. No. 1100) analog
| Alternate Names: | SK&F 104864-A |
| Chemical Name: | 10-[(Dimethylamino)methyl]-4-ethyl-4,9-dihydroxy-1H-pyrano[3',4':6,7]indolizino[1,2-b]quinoline-3,14(4H,12H)-dione hydrochloride |
| Purity: | ≥98% (HPLC) |
Cytostatic agent; exhibits DNA alkylating and purine analog properties
| Chemical Name: | 5-[Bis(2-chloroethyl)amino]-1-methyl-1H-benzimidazole-2-butanoic acid hydrochloride |
| Purity: | ≥98% (HPLC) |
IKBKAP pre-mRNA splicing modulator
| Chemical Name: | 2-Chloro-N-(2-furanylmethyl)-7H-purin-6-amine |
| Purity: | ≥98% (HPLC) |
Potent flap endonuclease 1 (FEN1) inhibitor; induces DNA damage response
| Chemical Name: | 1-[(2,3-Dihydro-1,4-benzodioxin-2-yl)methyl]-3-hydroxythieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Purity: | ≥98% (HPLC) |
Hypoxia-activated DNA alkylating agent prodrug
| Chemical Name: | (1-Methyl-2-nitro-1H-imidazol-5-yl)methyl N,N'-bis(2-bromoethyl)phosphorodiamidate |
| Applications: | AdAct |
| Purity: | ≥98% (HPLC) |
Auxin antagonist of TIR1/AFB receptors; also OsTIR1 inhibitor in auxin-inducible degron (AID) system
| Chemical Name: | α-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-indole-3-acetic acid |
| Purity: | ≥98% (HPLC) |
Binds to SARS-CoV-2 frameshifting element and reduces frameshifting efficiency
| Chemical Name: | 3-[[4-(Methylamino)-2-quinazolinyl]amino]benzoic acid |
| Purity: | ≥98% (HPLC) |
HIV RNA splicing modulator
| Chemical Name: | 8-Chloro-N-[4-(trifluoromethoxy)phenyl]-2-quinolinamine |
| Purity: | ≥98% (HPLC) |
Selective SMN2 gene splicing modifier
| Chemical Name: | 7-(4,7-Diazaspiro[2.5]oct-7-yl)-2-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-4H-pyrido[1,2-a]pyrimidin-4-one |
| Purity: | ≥98% (HPLC) |
Synthetic thymidine analog; used for cell proliferation assays
| Chemical Name: | 5-Bromo-2-deoxyuridine |
| Purity: | ≥99% (HPLC) |
Modulator of alternative polyadenylation; inhibits rod photoreceptor gene expression via Nr2e3
| Chemical Name: | 6,7-Dimethoxy-2-[((4-phenyl-3,6-dihydropyridin-1(2H)-yl)methyl)]quinazolin-4(3H)-one |
| Purity: | ≥98% (HPLC) |
Potent and selective DYRK1A inhibitor
| Chemical Name: | 7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole |
| Purity: | ≥98% (HPLC) |
eIF4A inhibitor
| Chemical Name: | 2-(5-(4-Butylphenyl)furan-2-yl)-6-nitroquinoline-4-carboxylic acid |
| Applications: | CellVia |
| Purity: | ≥98% (HPLC) |
