Molecular Glues Products
15 results for "Molecular Glues" in Products
15 results for "Molecular Glues" in Products
Molecular Glues Products
STING agonist, molecular glue that causes oligomerization of STING
| Chemical Name: | 4-((4-(2-(tert-Butyl)-5,5-dimethyl-1,3-dioxan-2-yl)benzyl)amino)-3-methoxybenzoic acid |
| Purity: | ≥98% (HPLC) |
Molecular glue; induces degradation of BCL6
| Chemical Name: | rel-5-[[5-Chloro-2-[(3R,5S)-4,4-difluoro-3,5-dimethyl-1-piperidinyl]-4-pyrimidinyl]amino]-1,3-dihydro-3-(3-hydroxy-3-methylbutyl)-1-methyl-2H-benzimidazol-2-one |
| Purity: | ≥98% (HPLC) |
Potent and selective CK1α molecular glue Degrader
| Chemical Name: | 3-(5-(Benzo[d]isoxazol-3-ylamino)-1-oxoisoindolin-2-yl)piperidine-2,6-dione |
| Purity: | ≥98% (HPLC) |
Molecular glue; induces degradation of GSPT1/2
| Chemical Name: | N-(2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)-2-(trifluoromethoxy)benzenesulfonamide |
| Purity: | ≥98% (HPLC) |
Molecular glue; pre-mRNA splicing modulator
| Chemical Name: | N1-(3-Chloro-1H-indol-7-yl)-1,4-benzenedisulfonamide |
| Purity: | ≥98% (HPLC) |
Molecular glue; induces degradation of CCNK and CDK12
| Chemical Name: | 6,7-Dihydro-N-(5-methyl-2-thiazolyl)-5H-indeno[5,6-b]furan-3-acetamide |
| Purity: | ≥98% (HPLC) |
Molecular glue Degrader; induces ubiquitination and degradation of cyclin K
| Chemical Name: | N-(5-Chloro-2-pyridinyl)-2-(5H-1,2,4-triazino[5,6-b]indol-3-ylthio)acetamide |
| Purity: | ≥98% (HPLC) |
Potent molecular glue Degrader of BET proteins BRD4 and BRD2
| Chemical Name: | tert-Butyl 2-((S)-4-(4-((4'-((S)-6-(2-(tert-butoxy)-2-oxoethyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-4-yl)-[1,1'-biphenyl]-4-carboxamido)methyl)phenyl)-2,3,9-trimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepin-6-yl)acetate |
Molecular glue Degrader of mutant β-catenin
| Chemical Name: | 2-[[4-[(2,6-Dichlorophenyl)thio]-1,2-dihydro-2-oxo-6-(trifluoromethyl)-3-pyridinyl]carbonyl]-2,3-dihydro-1H-isoindole-4-carbonitrile |
| Purity: | ≥98% (HPLC) |
Molecular glue; induces degradation of NQAT1
| Alternate Names: | Selective NTAQ1 degrader |
| Chemical Name: | 3-[6-[(Fluorosulfonyl)oxy]-1,3-dihydro-1-oxo-2H-isoindol-2-yl]-2,6-piperidinedione |
| Purity: | ≥95% (HPLC) |
Chemical dimerizer used in auxin-inducible degron (AID) system; phytohormone
| Chemical Name: | 1H-Indole-3-acetic acid |
| Purity: | ≥98% (HPLC) |
RNF126 chemical handle
| Chemical Name: | 1-(4-Methoxyphenyl)-4-(1-piperazinyl)-2-butene-1,4-dione hydrochloride |
| Purity: | ≥95% (HPLC) |
Auxin antagonist of TIR1/AFB receptors; also OsTIR1 inhibitor in auxin-inducible degron (AID) system
| Chemical Name: | α-[2-(2,4-Dimethylphenyl)-2-oxoethyl]-1H-indole-3-acetic acid |
| Purity: | ≥98% (HPLC) |
α2 integrin inhibitor; anti-angiogenic
| Chemical Name: | 3-Cyano-N-(3-cyano-4-methyl-1H-indol-7-yl)benzenesulfonamide |
| Purity: | ≥98% (HPLC) |
RNF126 chemical handle; alkyne functionalized version of JP-2-196 (Cat. No. 8046).
| Chemical Name: | 1-(4-Methoxyphenyl)-4-[4-(2-propyn-1-yl)-1-piperazinyl]-2-butene-1,4-dione |
| Purity: | ≥95% (HPLC) |
